C22H32N4O — CID 47000556
N-(2,2-dimethyloxan-4-yl)-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine (PubChem CID 47000556) has the molecular formula C22H32N4O and a molecular weight of 368.52 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 47000556 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1-[4-(2-methylimidazol-1-yl)phenyl]piperidin-4-amine |
| SMILES | Cc1nccn1-c1ccc(N2CCC(NC3CCOC(C)(C)C3)CC2)cc1 |
| InChI | InChI=1S/C22H32N4O/c1-17-23-11-14-26(17)21-6-4-20(5-7-21)25-12-8-18(9-13-25)24-19-10-15-27-22(2,3)16-19/h4-7,11,14,18-19,24H,8-10,12-13,15-16H2,1-3H3 |
| InChIKey | YMWBCKZXMDNBQD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|