About 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride
3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 47000692) has the molecular formula C9H11ClN2O2
and a molecular weight of 214.65 g/mol. Its IUPAC name is 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride |
| PubChem CID | 47000692 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | COc1ccc2c(c1)NC(=O)C2N.Cl |
| InChI | InChI=1S/C9H10N2O2.ClH/c1-13-5-2-3-6-7(4-5)11-9(12)8(6)10;/h2-4,8H,10H2,1H3,(H,11,12);1H |
| InChIKey | GGYQJXWGRFYOMD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride?
The IUPAC name of 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride (CID 47000692) is 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride.
What is the SMILES notation for 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride?
The canonical SMILES for 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride is COc1ccc2c(c1)NC(=O)C2N.Cl.
What is the InChIKey of 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride?
The InChIKey is GGYQJXWGRFYOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2.ClH/c1-13-5-2-3-6-7(4-5)11-9(12)8(6)10;/h2-4,8H,10H2,1H3,(H,11,12);1H.
What are the key properties of 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride?
3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride has a molecular weight of 214.65 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride is sourced from PubChem (CID 47000692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).