About 4,5-diethyl-2-methylpyrazol-3-amine;hydrate
4,5-diethyl-2-methylpyrazol-3-amine;hydrate (PubChem CID 47000727) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4,5-diethyl-2-methylpyrazol-3-amine;hydrate.
Molecular Properties
| Compound Name | 4,5-diethyl-2-methylpyrazol-3-amine;hydrate |
| PubChem CID | 47000727 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4,5-diethyl-2-methylpyrazol-3-amine;hydrate |
| SMILES | CCc1nn(C)c(N)c1CC.O |
| InChI | InChI=1S/C8H15N3.H2O/c1-4-6-7(5-2)10-11(3)8(6)9;/h4-5,9H2,1-3H3;1H2 |
| InChIKey | OZYHDGQTHKWQGD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-diethyl-2-methylpyrazol-3-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-2-methylpyrazol-3-amine;hydrate?
The IUPAC name of 4,5-diethyl-2-methylpyrazol-3-amine;hydrate (CID 47000727) is 4,5-diethyl-2-methylpyrazol-3-amine;hydrate.
What is the SMILES notation for 4,5-diethyl-2-methylpyrazol-3-amine;hydrate?
The canonical SMILES for 4,5-diethyl-2-methylpyrazol-3-amine;hydrate is CCc1nn(C)c(N)c1CC.O.
What is the InChIKey of 4,5-diethyl-2-methylpyrazol-3-amine;hydrate?
The InChIKey is OZYHDGQTHKWQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.H2O/c1-4-6-7(5-2)10-11(3)8(6)9;/h4-5,9H2,1-3H3;1H2.
What are the key properties of 4,5-diethyl-2-methylpyrazol-3-amine;hydrate?
4,5-diethyl-2-methylpyrazol-3-amine;hydrate has a molecular weight of 171.24 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-2-methylpyrazol-3-amine;hydrate is sourced from PubChem (CID 47000727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).