About 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride
2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (PubChem CID 47000736) has the molecular formula C7H16Cl2N4
and a molecular weight of 227.14 g/mol. Its IUPAC name is 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| PubChem CID | 47000736 |
| Molecular Formula | C7H16Cl2N4 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| SMILES | CC(C)n1cnnc1CCN.Cl.Cl |
| InChI | InChI=1S/C7H14N4.2ClH/c1-6(2)11-5-9-10-7(11)3-4-8;;/h5-6H,3-4,8H2,1-2H3;2*1H |
| InChIKey | VFNAJRFMRSYXED-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride?
The IUPAC name of 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (CID 47000736) is 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride?
The canonical SMILES for 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride is CC(C)n1cnnc1CCN.Cl.Cl.
What is the InChIKey of 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride?
The InChIKey is VFNAJRFMRSYXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4.2ClH/c1-6(2)11-5-9-10-7(11)3-4-8;;/h5-6H,3-4,8H2,1-2H3;2*1H.
What are the key properties of 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride?
2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride has a molecular weight of 227.14 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 47000736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).