About 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride
2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride (PubChem CID 47000789) has the molecular formula C7H15ClN4
and a molecular weight of 190.68 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride |
| PubChem CID | 47000789 |
| Molecular Formula | C7H15ClN4 |
| Molecular Weight | 190.68 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride |
| SMILES | CC(C)C(N)c1ncnn1C.Cl |
| InChI | InChI=1S/C7H14N4.ClH/c1-5(2)6(8)7-9-4-10-11(7)3;/h4-6H,8H2,1-3H3;1H |
| InChIKey | LVRYQGLMOJOUSB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.68 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride?
The IUPAC name of 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride (CID 47000789) is 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride?
The canonical SMILES for 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride is CC(C)C(N)c1ncnn1C.Cl.
What is the InChIKey of 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride?
The InChIKey is LVRYQGLMOJOUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4.ClH/c1-5(2)6(8)7-9-4-10-11(7)3;/h4-6H,8H2,1-3H3;1H.
What are the key properties of 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride?
2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride has a molecular weight of 190.68 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 47000789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).