C13H11ClF3N3O — CID 47001423
N-(3-chloro-4-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 47001423) has the molecular formula C13H11ClF3N3O and a molecular weight of 317.70 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47001423 |
| Molecular Formula | C13H11ClF3N3O |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)n(C)n2)cc1Cl |
| InChI | InChI=1S/C13H11ClF3N3O/c1-7-3-4-8(5-9(7)14)18-12(21)10-6-11(13(15,16)17)20(2)19-10/h3-6H,1-2H3,(H,18,21) |
| InChIKey | ZKNUOTRKXDYAEZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |