C24H30N2O3 — CID 47002038
ethyl 2-[4-[[2-(4-methylphenyl)azepane-1-carbonyl]amino]phenyl]acetate (PubChem CID 47002038) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(4-methylphenyl)azepane-1-carbonyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[2-(4-methylphenyl)azepane-1-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 47002038 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | ethyl 2-[4-[[2-(4-methylphenyl)azepane-1-carbonyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)N2CCCCCC2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-29-23(27)17-19-10-14-21(15-11-19)25-24(28)26-16-6-4-5-7-22(26)20-12-8-18(2)9-13-20/h8-15,22H,3-7,16-17H2,1-2H3,(H,25,28) |
| InChIKey | GVQCEOJEVJMBCO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |