About 2,2-dimethylcyclopropan-1-amine;hydrochloride
2,2-dimethylcyclopropan-1-amine;hydrochloride (PubChem CID 47002150) has the molecular formula C5H12ClN
and a molecular weight of 121.61 g/mol. Its IUPAC name is 2,2-dimethylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-dimethylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 47002150 |
| Molecular Formula | C5H12ClN |
| Molecular Weight | 121.61 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | 2,2-dimethylcyclopropan-1-amine;hydrochloride |
| SMILES | CC1(C)CC1N.Cl |
| InChI | InChI=1S/C5H11N.ClH/c1-5(2)3-4(5)6;/h4H,3,6H2,1-2H3;1H |
| InChIKey | LIVDXAAZXJCHPC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.61 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylcyclopropan-1-amine;hydrochloride?
The IUPAC name of 2,2-dimethylcyclopropan-1-amine;hydrochloride (CID 47002150) is 2,2-dimethylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for 2,2-dimethylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for 2,2-dimethylcyclopropan-1-amine;hydrochloride is CC1(C)CC1N.Cl.
What is the InChIKey of 2,2-dimethylcyclopropan-1-amine;hydrochloride?
The InChIKey is LIVDXAAZXJCHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.ClH/c1-5(2)3-4(5)6;/h4H,3,6H2,1-2H3;1H.
What are the key properties of 2,2-dimethylcyclopropan-1-amine;hydrochloride?
2,2-dimethylcyclopropan-1-amine;hydrochloride has a molecular weight of 121.61 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 47002150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).