About 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride
3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride (PubChem CID 47002154) has the molecular formula C7H12ClN3O
and a molecular weight of 189.65 g/mol. Its IUPAC name is 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride |
| PubChem CID | 47002154 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.c1nc(C2CCCCN2)no1 |
| InChI | InChI=1S/C7H11N3O.ClH/c1-2-4-8-6(3-1)7-9-5-11-10-7;/h5-6,8H,1-4H2;1H |
| InChIKey | PKKXNVYIELGLRW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride?
The IUPAC name of 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride (CID 47002154) is 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride.
What is the SMILES notation for 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride?
The canonical SMILES for 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride is Cl.c1nc(C2CCCCN2)no1.
What is the InChIKey of 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride?
The InChIKey is PKKXNVYIELGLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.ClH/c1-2-4-8-6(3-1)7-9-5-11-10-7;/h5-6,8H,1-4H2;1H.
What are the key properties of 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride?
3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride has a molecular weight of 189.65 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride is sourced from PubChem (CID 47002154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).