About 3-amino-1H-pyridin-2-one;hydrochloride
3-amino-1H-pyridin-2-one;hydrochloride (PubChem CID 47002579) has the molecular formula C5H7ClN2O
and a molecular weight of 146.58 g/mol. Its IUPAC name is 3-amino-1H-pyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-1H-pyridin-2-one;hydrochloride |
| PubChem CID | 47002579 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 3-amino-1H-pyridin-2-one;hydrochloride |
| SMILES | Cl.Nc1ccc[nH]c1=O |
| InChI | InChI=1S/C5H6N2O.ClH/c6-4-2-1-3-7-5(4)8;/h1-3H,6H2,(H,7,8);1H |
| InChIKey | YJQBZFOBZMDVHX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1H-pyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1H-pyridin-2-one;hydrochloride?
The IUPAC name of 3-amino-1H-pyridin-2-one;hydrochloride (CID 47002579) is 3-amino-1H-pyridin-2-one;hydrochloride.
What is the SMILES notation for 3-amino-1H-pyridin-2-one;hydrochloride?
The canonical SMILES for 3-amino-1H-pyridin-2-one;hydrochloride is Cl.Nc1ccc[nH]c1=O.
What is the InChIKey of 3-amino-1H-pyridin-2-one;hydrochloride?
The InChIKey is YJQBZFOBZMDVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.ClH/c6-4-2-1-3-7-5(4)8;/h1-3H,6H2,(H,7,8);1H.
What are the key properties of 3-amino-1H-pyridin-2-one;hydrochloride?
3-amino-1H-pyridin-2-one;hydrochloride has a molecular weight of 146.58 g/mol, XLogP of 0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1H-pyridin-2-one;hydrochloride is sourced from PubChem (CID 47002579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).