About 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one
5-(1-hydroxyethyl)-1,3-dihydroindol-2-one (PubChem CID 47002707) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one |
| PubChem CID | 47002707 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one |
| SMILES | CC(O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H11NO2/c1-6(12)7-2-3-9-8(4-7)5-10(13)11-9/h2-4,6,12H,5H2,1H3,(H,11,13) |
| InChIKey | NLGRBBXVQWRUMU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one?
The IUPAC name of 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one (CID 47002707) is 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one is CC(O)c1ccc2c(c1)CC(=O)N2.
What is the InChIKey of 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one?
The InChIKey is NLGRBBXVQWRUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6(12)7-2-3-9-8(4-7)5-10(13)11-9/h2-4,6,12H,5H2,1H3,(H,11,13).
What are the key properties of 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one?
5-(1-hydroxyethyl)-1,3-dihydroindol-2-one has a molecular weight of 177.20 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxyethyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 47002707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).