About 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine
1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine (PubChem CID 47002772) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 47002772 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(Cc2ccccn2)n1 |
| InChI | InChI=1S/C8H9N5/c9-8-11-6-13(12-8)5-7-3-1-2-4-10-7/h1-4,6H,5H2,(H2,9,12) |
| InChIKey | FKLFQTLLGKCEKY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine (CID 47002772) is 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine is Nc1ncn(Cc2ccccn2)n1.
What is the InChIKey of 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine?
The InChIKey is FKLFQTLLGKCEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c9-8-11-6-13(12-8)5-7-3-1-2-4-10-7/h1-4,6H,5H2,(H2,9,12).
What are the key properties of 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine?
1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine has a molecular weight of 175.19 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 47002772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).