About N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride
N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 47002788) has the molecular formula C8H17ClN2OS
and a molecular weight of 224.76 g/mol. Its IUPAC name is N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| PubChem CID | 47002788 |
| Molecular Formula | C8H17ClN2OS |
| Molecular Weight | 224.76 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CCC(C)NC(=O)C1CSCN1.Cl |
| InChI | InChI=1S/C8H16N2OS.ClH/c1-3-6(2)10-8(11)7-4-12-5-9-7;/h6-7,9H,3-5H2,1-2H3,(H,10,11);1H |
| InChIKey | FGPXMXKRSVSRAX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.76 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The IUPAC name of N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride (CID 47002788) is N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride is CCC(C)NC(=O)C1CSCN1.Cl.
What is the InChIKey of N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The InChIKey is FGPXMXKRSVSRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2OS.ClH/c1-3-6(2)10-8(11)7-4-12-5-9-7;/h6-7,9H,3-5H2,1-2H3,(H,10,11);1H.
What are the key properties of N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride?
N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride has a molecular weight of 224.76 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1,3-thiazolidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 47002788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).