About N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride
N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 47002810) has the molecular formula C8H15ClN2OS
and a molecular weight of 222.74 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| PubChem CID | 47002810 |
| Molecular Formula | C8H15ClN2OS |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CN(C(=O)C1CSCN1)C1CC1.Cl |
| InChI | InChI=1S/C8H14N2OS.ClH/c1-10(6-2-3-6)8(11)7-4-12-5-9-7;/h6-7,9H,2-5H2,1H3;1H |
| InChIKey | QTGZOIGZCIJGBO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The IUPAC name of N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride (CID 47002810) is N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride is CN(C(=O)C1CSCN1)C1CC1.Cl.
What is the InChIKey of N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride?
The InChIKey is QTGZOIGZCIJGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS.ClH/c1-10(6-2-3-6)8(11)7-4-12-5-9-7;/h6-7,9H,2-5H2,1H3;1H.
What are the key properties of N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride?
N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride has a molecular weight of 222.74 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 47002810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).