About 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride
1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride (PubChem CID 47002851) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride |
| PubChem CID | 47002851 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C9H11NO.ClH/c10-4-7-1-2-8-5-11-6-9(8)3-7;/h1-3H,4-6,10H2;1H |
| InChIKey | JDRYRWYXGCKYNS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride?
The IUPAC name of 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride (CID 47002851) is 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride.
What is the SMILES notation for 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride?
The canonical SMILES for 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride is Cl.NCc1ccc2c(c1)COC2.
What is the InChIKey of 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride?
The InChIKey is JDRYRWYXGCKYNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.ClH/c10-4-7-1-2-8-5-11-6-9(8)3-7;/h1-3H,4-6,10H2;1H.
What are the key properties of 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride?
1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride has a molecular weight of 185.65 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride is sourced from PubChem (CID 47002851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).