About (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol
(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol (PubChem CID 47002907) has the molecular formula C8H6Cl2N2O
and a molecular weight of 217.06 g/mol. Its IUPAC name is (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol |
| PubChem CID | 47002907 |
| Molecular Formula | C8H6Cl2N2O |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol |
| SMILES | OCc1cn2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C8H6Cl2N2O/c9-5-1-7(10)8-11-6(4-13)3-12(8)2-5/h1-3,13H,4H2 |
| InChIKey | UQMZXSKGXBNAJE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol?
The IUPAC name of (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol (CID 47002907) is (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol.
What is the SMILES notation for (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol?
The canonical SMILES for (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol is OCc1cn2cc(Cl)cc(Cl)c2n1.
What is the InChIKey of (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol?
The InChIKey is UQMZXSKGXBNAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O/c9-5-1-7(10)8-11-6(4-13)3-12(8)2-5/h1-3,13H,4H2.
What are the key properties of (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol?
(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol has a molecular weight of 217.06 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanol is sourced from PubChem (CID 47002907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).