About 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride
3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (PubChem CID 47003044) has the molecular formula C7H5ClN2O3S
and a molecular weight of 232.65 g/mol. Its IUPAC name is 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| PubChem CID | 47003044 |
| Molecular Formula | C7H5ClN2O3S |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| SMILES | Cc1noc2ncc(S(=O)(=O)Cl)cc12 |
| InChI | InChI=1S/C7H5ClN2O3S/c1-4-6-2-5(14(8,11)12)3-9-7(6)13-10-4/h2-3H,1H3 |
| InChIKey | JGKTYJARBKWGGM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The IUPAC name of 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CID 47003044) is 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
What is the SMILES notation for 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The canonical SMILES for 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is Cc1noc2ncc(S(=O)(=O)Cl)cc12.
What is the InChIKey of 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The InChIKey is JGKTYJARBKWGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O3S/c1-4-6-2-5(14(8,11)12)3-9-7(6)13-10-4/h2-3H,1H3.
What are the key properties of 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride has a molecular weight of 232.65 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is sourced from PubChem (CID 47003044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).