About 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride
2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride (PubChem CID 47003170) has the molecular formula C5H12ClF2NO
and a molecular weight of 175.61 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride |
| PubChem CID | 47003170 |
| Molecular Formula | C5H12ClF2NO |
| Molecular Weight | 175.61 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride |
| SMILES | COCCNCC(F)F.Cl |
| InChI | InChI=1S/C5H11F2NO.ClH/c1-9-3-2-8-4-5(6)7;/h5,8H,2-4H2,1H3;1H |
| InChIKey | ALDZFQLZDYAAJH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.61 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride?
The IUPAC name of 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride (CID 47003170) is 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride.
What is the SMILES notation for 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride?
The canonical SMILES for 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride is COCCNCC(F)F.Cl.
What is the InChIKey of 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride?
The InChIKey is ALDZFQLZDYAAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F2NO.ClH/c1-9-3-2-8-4-5(6)7;/h5,8H,2-4H2,1H3;1H.
What are the key properties of 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride?
2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride has a molecular weight of 175.61 g/mol, XLogP of 0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N-(2-methoxyethyl)ethanamine;hydrochloride is sourced from PubChem (CID 47003170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).