C11H15ClN2O2S — CID 47003209
N-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 47003209) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 47003209 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CSCN2)cc1.Cl |
| InChI | InChI=1S/C11H14N2O2S.ClH/c1-15-9-4-2-8(3-5-9)13-11(14)10-6-16-7-12-10;/h2-5,10,12H,6-7H2,1H3,(H,13,14);1H |
| InChIKey | NYNCWESKXAEVHN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |