About 2-(3-cyano-1,2,4-triazol-1-yl)acetamide
2-(3-cyano-1,2,4-triazol-1-yl)acetamide (PubChem CID 47003260) has the molecular formula C5H5N5O
and a molecular weight of 151.13 g/mol. Its IUPAC name is 2-(3-cyano-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-cyano-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 47003260 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 2-(3-cyano-1,2,4-triazol-1-yl)acetamide |
| SMILES | N#Cc1ncn(CC(N)=O)n1 |
| InChI | InChI=1S/C5H5N5O/c6-1-5-8-3-10(9-5)2-4(7)11/h3H,2H2,(H2,7,11) |
| InChIKey | IMCWBQIDQSRZMJ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-cyano-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)acetamide (CID 47003260) is 2-(3-cyano-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for 2-(3-cyano-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for 2-(3-cyano-1,2,4-triazol-1-yl)acetamide is N#Cc1ncn(CC(N)=O)n1.
What is the InChIKey of 2-(3-cyano-1,2,4-triazol-1-yl)acetamide?
The InChIKey is IMCWBQIDQSRZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O/c6-1-5-8-3-10(9-5)2-4(7)11/h3H,2H2,(H2,7,11).
What are the key properties of 2-(3-cyano-1,2,4-triazol-1-yl)acetamide?
2-(3-cyano-1,2,4-triazol-1-yl)acetamide has a molecular weight of 151.13 g/mol, XLogP of -1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 47003260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).