About [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine
[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 47003290) has the molecular formula C9H9BrN4
and a molecular weight of 253.10 g/mol. Its IUPAC name is [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| PubChem CID | 47003290 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | NCc1nc(-c2ccc(Br)cc2)n[nH]1 |
| InChI | InChI=1S/C9H9BrN4/c10-7-3-1-6(2-4-7)9-12-8(5-11)13-14-9/h1-4H,5,11H2,(H,12,13,14) |
| InChIKey | YCPMYQCFQXLMLH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine?
The IUPAC name of [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine (CID 47003290) is [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine.
What is the SMILES notation for [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine?
The canonical SMILES for [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine is NCc1nc(-c2ccc(Br)cc2)n[nH]1.
What is the InChIKey of [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine?
The InChIKey is YCPMYQCFQXLMLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4/c10-7-3-1-6(2-4-7)9-12-8(5-11)13-14-9/h1-4H,5,11H2,(H,12,13,14).
What are the key properties of [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine?
[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine has a molecular weight of 253.10 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine is sourced from PubChem (CID 47003290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).