C9H15N3O2 — CID 47003356
tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate (PubChem CID 47003356) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 47003356 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn[nH]c1 |
| InChI | InChI=1S/C9H15N3O2/c1-9(2,3)14-8(13)10-4-7-5-11-12-6-7/h5-6H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | QHQQGFZVUMTRDH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |