About (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol
(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 47003491) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol.
Molecular Properties
| Compound Name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| PubChem CID | 47003491 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | O=S1(=O)CC[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C9H10O3S/c10-8-5-6-13(11,12)9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m1/s1 |
| InChIKey | HDWSBBCZEGJIPK-MRVPVSSYSA-N |
| XLogP | 0.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol?
The IUPAC name of (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (CID 47003491) is (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol.
What is the SMILES notation for (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol?
The canonical SMILES for (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol is O=S1(=O)CC[C@@H](O)c2ccccc21.
What is the InChIKey of (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol?
The InChIKey is HDWSBBCZEGJIPK-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H10O3S/c10-8-5-6-13(11,12)9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m1/s1.
What are the key properties of (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol?
(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol has a molecular weight of 198.24 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol is sourced from PubChem (CID 47003491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).