About 2H-chromene-3-sulfonyl chloride
2H-chromene-3-sulfonyl chloride (PubChem CID 47003548) has the molecular formula C9H7ClO3S
and a molecular weight of 230.67 g/mol. Its IUPAC name is 2H-chromene-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 2H-chromene-3-sulfonyl chloride |
| PubChem CID | 47003548 |
| Molecular Formula | C9H7ClO3S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 2H-chromene-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C9H7ClO3S/c10-14(11,12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2 |
| InChIKey | XGCKSIZJWKXGMW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-chromene-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene-3-sulfonyl chloride?
The IUPAC name of 2H-chromene-3-sulfonyl chloride (CID 47003548) is 2H-chromene-3-sulfonyl chloride.
What is the SMILES notation for 2H-chromene-3-sulfonyl chloride?
The canonical SMILES for 2H-chromene-3-sulfonyl chloride is O=S(=O)(Cl)C1=Cc2ccccc2OC1.
What is the InChIKey of 2H-chromene-3-sulfonyl chloride?
The InChIKey is XGCKSIZJWKXGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3S/c10-14(11,12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2.
What are the key properties of 2H-chromene-3-sulfonyl chloride?
2H-chromene-3-sulfonyl chloride has a molecular weight of 230.67 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene-3-sulfonyl chloride is sourced from PubChem (CID 47003548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).