About 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride
6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride (PubChem CID 47003571) has the molecular formula C11H10Cl2O3S
and a molecular weight of 293.17 g/mol. Its IUPAC name is 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride |
| PubChem CID | 47003571 |
| Molecular Formula | C11H10Cl2O3S |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride |
| SMILES | Cc1cc2c(c(C)c1Cl)C=C(S(=O)(=O)Cl)CO2 |
| InChI | InChI=1S/C11H10Cl2O3S/c1-6-3-10-9(7(2)11(6)12)4-8(5-16-10)17(13,14)15/h3-4H,5H2,1-2H3 |
| InChIKey | KXFQZPAZSIZMSV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride?
The IUPAC name of 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride (CID 47003571) is 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride.
What is the SMILES notation for 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride?
The canonical SMILES for 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride is Cc1cc2c(c(C)c1Cl)C=C(S(=O)(=O)Cl)CO2.
What is the InChIKey of 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride?
The InChIKey is KXFQZPAZSIZMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O3S/c1-6-3-10-9(7(2)11(6)12)4-8(5-16-10)17(13,14)15/h3-4H,5H2,1-2H3.
What are the key properties of 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride?
6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride has a molecular weight of 293.17 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5,7-dimethyl-2H-chromene-3-sulfonyl chloride is sourced from PubChem (CID 47003571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).