About [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate (PubChem CID 47003938) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate |
| PubChem CID | 47003938 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate |
| SMILES | COc1ccc(C(=O)C(C)OC(=O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H15NO4/c1-12(17(20)14-7-9-16(22-2)10-8-14)23-18(21)15-5-3-13(11-19)4-6-15/h3-10,12H,1-2H3 |
| InChIKey | MMIOKVDKXGJMAJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate?
The IUPAC name of [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate (CID 47003938) is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate.
What is the SMILES notation for [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate?
The canonical SMILES for [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate is COc1ccc(C(=O)C(C)OC(=O)c2ccc(C#N)cc2)cc1.
What is the InChIKey of [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate?
The InChIKey is MMIOKVDKXGJMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4/c1-12(17(20)14-7-9-16(22-2)10-8-14)23-18(21)15-5-3-13(11-19)4-6-15/h3-10,12H,1-2H3.
What are the key properties of [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate?
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate has a molecular weight of 309.32 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4-cyanobenzoate is sourced from PubChem (CID 47003938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).