C24H21N5O3S — CID 47005073
1-benzyl-3-methyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 47005073) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is 1-benzyl-3-methyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-benzyl-3-methyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47005073 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-benzyl-3-methyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c2sc(C(=O)NN3C(=O)NC(C)(c4ccccc4)C3=O)cc12 |
| InChI | InChI=1S/C24H21N5O3S/c1-15-18-13-19(33-21(18)28(26-15)14-16-9-5-3-6-10-16)20(30)27-29-22(31)24(2,25-23(29)32)17-11-7-4-8-12-17/h3-13H,14H2,1-2H3,(H,25,32)(H,27,30) |
| InChIKey | ATWDQUMUFSNSKH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|