C19H19IN2O3 — CID 47006291
methyl 2-[2-(3-iodoanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 47006291) has the molecular formula C19H19IN2O3 and a molecular weight of 450.28 g/mol. Its IUPAC name is methyl 2-[2-(3-iodoanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 2-[2-(3-iodoanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 47006291 |
| Molecular Formula | C19H19IN2O3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | methyl 2-[2-(3-iodoanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2CN1CC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C19H19IN2O3/c1-25-19(24)17-9-13-5-2-3-6-14(13)11-22(17)12-18(23)21-16-8-4-7-15(20)10-16/h2-8,10,17H,9,11-12H2,1H3,(H,21,23) |
| InChIKey | IUYSDRXCGCKRNM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|