C20H22N2O4 — CID 47006858
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N,3-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 47006858) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N,3-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N,3-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 47006858 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N,3-dimethyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)CC2COc3ccccc3O2)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C20H22N2O4/c1-12-18-14(6-5-7-15(18)23)21-19(12)20(24)22(2)10-13-11-25-16-8-3-4-9-17(16)26-13/h3-4,8-9,13,21H,5-7,10-11H2,1-2H3 |
| InChIKey | COORQAUSJLBQEK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |