C17H23N5OS — CID 47007671
5-methyl-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide (PubChem CID 47007671) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 5-methyl-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47007671 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-methyl-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCC(c2cccs2)N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C17H23N5OS/c1-13-10-19-14(11-18-13)17(23)20-12-15(16-4-3-9-24-16)22-7-5-21(2)6-8-22/h3-4,9-11,15H,5-8,12H2,1-2H3,(H,20,23) |
| InChIKey | VMYMCLGCTUNHPN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |