C20H13FN2O2 — CID 47008040
5-(2-fluorophenyl)-N-quinolin-2-ylfuran-2-carboxamide (PubChem CID 47008040) has the molecular formula C20H13FN2O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-quinolin-2-ylfuran-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-quinolin-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 47008040 |
| Molecular Formula | C20H13FN2O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 5-(2-fluorophenyl)-N-quinolin-2-ylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2n1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C20H13FN2O2/c21-15-7-3-2-6-14(15)17-10-11-18(25-17)20(24)23-19-12-9-13-5-1-4-8-16(13)22-19/h1-12H,(H,22,23,24) |
| InChIKey | XFQISOLGNMLGJI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |