C16H23ClN4O — CID 47008281
N-[2-[(4-imidazol-1-ylphenyl)methylamino]ethyl]-2-methylpropanamide;hydrochloride (PubChem CID 47008281) has the molecular formula C16H23ClN4O and a molecular weight of 322.84 g/mol. Its IUPAC name is N-[2-[(4-imidazol-1-ylphenyl)methylamino]ethyl]-2-methylpropanamide;hydrochloride.
| Compound Name | N-[2-[(4-imidazol-1-ylphenyl)methylamino]ethyl]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 47008281 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | N-[2-[(4-imidazol-1-ylphenyl)methylamino]ethyl]-2-methylpropanamide;hydrochloride |
| SMILES | CC(C)C(=O)NCCNCc1ccc(-n2ccnc2)cc1.Cl |
| InChI | InChI=1S/C16H22N4O.ClH/c1-13(2)16(21)19-8-7-17-11-14-3-5-15(6-4-14)20-10-9-18-12-20;/h3-6,9-10,12-13,17H,7-8,11H2,1-2H3,(H,19,21);1H |
| InChIKey | NJJAEBMLGAXJSF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|