C16H15NO3S — CID 47009511
(1-amino-1-oxopropan-2-yl) (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 47009511) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 47009511 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(-c2ccccc2)s1)C(N)=O |
| InChI | InChI=1S/C16H15NO3S/c1-11(16(17)19)20-15(18)10-8-13-7-9-14(21-13)12-5-3-2-4-6-12/h2-11H,1H3,(H2,17,19)/b10-8+ |
| InChIKey | HVBYGCUGXCKYPV-CSKARUKUSA-N |
| XLogP | 2.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|