C19H25N3O4 — CID 47009670
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]acetamide (PubChem CID 47009670) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 47009670 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-methoxy-5-methylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C)cc1CCNC(=O)CN1C(=O)NC(C)(C2CC2)C1=O |
| InChI | InChI=1S/C19H25N3O4/c1-12-4-7-15(26-3)13(10-12)8-9-20-16(23)11-22-17(24)19(2,14-5-6-14)21-18(22)25/h4,7,10,14H,5-6,8-9,11H2,1-3H3,(H,20,23)(H,21,25) |
| InChIKey | RGNHVJATAGHCAI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|