About N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide
N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 47010020) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| PubChem CID | 47010020 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1CSCC1=O)NC1CC1 |
| InChI | InChI=1S/C8H12N2O2S/c11-7(9-6-1-2-6)3-10-5-13-4-8(10)12/h6H,1-5H2,(H,9,11) |
| InChIKey | RBQTZKDDYAPXSA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The IUPAC name of N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (CID 47010020) is N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
What is the SMILES notation for N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The canonical SMILES for N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide is O=C(CN1CSCC1=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
The InChIKey is RBQTZKDDYAPXSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c11-7(9-6-1-2-6)3-10-5-13-4-8(10)12/h6H,1-5H2,(H,9,11).
What are the key properties of N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide?
N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide has a molecular weight of 200.26 g/mol, XLogP of -0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide is sourced from PubChem (CID 47010020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).