C24H27N3O6 — CID 47011551
[1-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate (PubChem CID 47011551) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is [1-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate.
| Compound Name | [1-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 47011551 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [1-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
| SMILES | CC(OC(=O)CCN1C(=O)C2CC=CCC2C1=O)C(=O)N1c2ccccc2NC(=O)C1(C)C |
| InChI | InChI=1S/C24H27N3O6/c1-14(20(29)27-18-11-7-6-10-17(18)25-23(32)24(27,2)3)33-19(28)12-13-26-21(30)15-8-4-5-9-16(15)22(26)31/h4-7,10-11,14-16H,8-9,12-13H2,1-3H3,(H,25,32) |
| InChIKey | VANJISHNWMXYNP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|