C23H20ClNO6 — CID 47011793
ethyl (5E)-2-anilino-5-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-4-oxofuran-3-carboxylate (PubChem CID 47011793) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is ethyl (5E)-2-anilino-5-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-4-oxofuran-3-carboxylate.
| Compound Name | ethyl (5E)-2-anilino-5-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 47011793 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | ethyl (5E)-2-anilino-5-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-4-oxofuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)O/C(=C/c2cc(Cl)c3c(c2)OCCCO3)C1=O |
| InChI | InChI=1S/C23H20ClNO6/c1-2-28-23(27)19-20(26)17(31-22(19)25-15-7-4-3-5-8-15)12-14-11-16(24)21-18(13-14)29-9-6-10-30-21/h3-5,7-8,11-13,25H,2,6,9-10H2,1H3/b17-12+ |
| InChIKey | QJOZDHXOUNTPIJ-SFQUDFHCSA-N |
| XLogP | 4.33 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|