C17H16FN3O3S2 — CID 47013010
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 47013010) has the molecular formula C17H16FN3O3S2 and a molecular weight of 393.47 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 47013010 |
| Molecular Formula | C17H16FN3O3S2 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(F)cc21)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C17H16FN3O3S2/c18-11-3-4-15-13(10-11)14(5-8-25-15)19-17(22)12-2-1-6-21-7-9-26(23,24)20-16(12)21/h1-4,6,10,14H,5,7-9H2,(H,19,22) |
| InChIKey | PENJBUAJAXJFAP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |