C11H16N2O3S — CID 47013160
N-(2-ethylphenyl)-2-(methanesulfonamido)acetamide (PubChem CID 47013160) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-(methanesulfonamido)acetamide.
| Compound Name | N-(2-ethylphenyl)-2-(methanesulfonamido)acetamide |
|---|---|
| PubChem CID | 47013160 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-(2-ethylphenyl)-2-(methanesulfonamido)acetamide |
| SMILES | CCc1ccccc1NC(=O)CNS(C)(=O)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-3-9-6-4-5-7-10(9)13-11(14)8-12-17(2,15)16/h4-7,12H,3,8H2,1-2H3,(H,13,14) |
| InChIKey | FNFLNGJXOPQQQP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |