C11H10N2O4 — CID 47013841
2-hydroxyethyl 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 47013841) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-hydroxyethyl 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | 2-hydroxyethyl 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 47013841 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-hydroxyethyl 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | O=C(OCCO)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C11H10N2O4/c14-5-6-17-11(16)9-7-3-1-2-4-8(7)10(15)13-12-9/h1-4,14H,5-6H2,(H,13,15) |
| InChIKey | IKSWIIMCZOWWTJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |