About 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 47014455) has the molecular formula C13H19N5O2
and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| PubChem CID | 47014455 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)Nc2cc(C)on2)n1 |
| InChI | InChI=1S/C13H19N5O2/c1-9-7-10(2)18(16-9)6-4-5-14-13(19)15-12-8-11(3)20-17-12/h7-8H,4-6H2,1-3H3,(H2,14,15,17,19) |
| InChIKey | VPBWGCHTNDQGBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea?
The IUPAC name of 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (CID 47014455) is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
What is the SMILES notation for 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea?
The canonical SMILES for 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea is Cc1cc(C)n(CCCNC(=O)Nc2cc(C)on2)n1.
What is the InChIKey of 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea?
The InChIKey is VPBWGCHTNDQGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O2/c1-9-7-10(2)18(16-9)6-4-5-14-13(19)15-12-8-11(3)20-17-12/h7-8H,4-6H2,1-3H3,(H2,14,15,17,19).
What are the key properties of 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea?
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea has a molecular weight of 277.33 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea is sourced from PubChem (CID 47014455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).