C14H12ClFN6 — CID 47016491
(Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-chloro-6-fluorophenyl)prop-2-enenitrile (PubChem CID 47016491) has the molecular formula C14H12ClFN6 and a molecular weight of 318.74 g/mol. Its IUPAC name is (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-chloro-6-fluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-chloro-6-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 47016491 |
| Molecular Formula | C14H12ClFN6 |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-chloro-6-fluorophenyl)prop-2-enenitrile |
| SMILES | CN(C)c1nc(N)nc(/C(C#N)=C\c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C14H12ClFN6/c1-22(2)14-20-12(19-13(18)21-14)8(7-17)6-9-10(15)4-3-5-11(9)16/h3-6H,1-2H3,(H2,18,19,20,21)/b8-6- |
| InChIKey | ONZHMTOCDJVTOO-VURMDHGXSA-N |
| XLogP | 2.38 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|