About N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine (PubChem CID 47016708) has the molecular formula C9H16ClN3O
and a molecular weight of 217.70 g/mol. Its IUPAC name is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine.
Molecular Properties
| Compound Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine |
| PubChem CID | 47016708 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C9H16ClN3O/c1-7-8(6-11-4-5-14-3)9(10)13(2)12-7/h11H,4-6H2,1-3H3 |
| InChIKey | OJAUBBPVWCZWIE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine?
The IUPAC name of N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine (CID 47016708) is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine.
What is the SMILES notation for N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine?
The canonical SMILES for N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine is COCCNCc1c(C)nn(C)c1Cl.
What is the InChIKey of N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine?
The InChIKey is OJAUBBPVWCZWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3O/c1-7-8(6-11-4-5-14-3)9(10)13(2)12-7/h11H,4-6H2,1-3H3.
What are the key properties of N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine?
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine has a molecular weight of 217.70 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-methoxyethanamine is sourced from PubChem (CID 47016708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).