About 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile
2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile (PubChem CID 47016842) has the molecular formula C16H10N4S2
and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile.
Molecular Properties
| Compound Name | 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile |
| PubChem CID | 47016842 |
| Molecular Formula | C16H10N4S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile |
| SMILES | N#Cc1c(CSc2ncnc3ccsc23)cn2ccccc12 |
| InChI | InChI=1S/C16H10N4S2/c17-7-12-11(8-20-5-2-1-3-14(12)20)9-22-16-15-13(4-6-21-15)18-10-19-16/h1-6,8,10H,9H2 |
| InChIKey | RPWNAYZOWYDAIQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile?
The IUPAC name of 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile (CID 47016842) is 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile.
What is the SMILES notation for 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile?
The canonical SMILES for 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile is N#Cc1c(CSc2ncnc3ccsc23)cn2ccccc12.
What is the InChIKey of 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile?
The InChIKey is RPWNAYZOWYDAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4S2/c17-7-12-11(8-20-5-2-1-3-14(12)20)9-22-16-15-13(4-6-21-15)18-10-19-16/h1-6,8,10H,9H2.
What are the key properties of 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile?
2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile has a molecular weight of 322.42 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thieno[3,2-d]pyrimidin-4-ylsulfanylmethyl)indolizine-1-carbonitrile is sourced from PubChem (CID 47016842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).