C22H26ClN3O2S — CID 47018799
4-(2-chlorophenyl)-N,N-diethyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide (PubChem CID 47018799) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N,N-diethyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide.
| Compound Name | 4-(2-chlorophenyl)-N,N-diethyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 47018799 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-(2-chlorophenyl)-N,N-diethyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CC(c2ccccc2Cl)c2c([nH]c3ccccc23)C1C |
| InChI | InChI=1S/C22H26ClN3O2S/c1-4-25(5-2)29(27,28)26-14-18(16-10-6-8-12-19(16)23)21-17-11-7-9-13-20(17)24-22(21)15(26)3/h6-13,15,18,24H,4-5,14H2,1-3H3 |
| InChIKey | NAWMQCOLNLIPHN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|