C17H17N3O5 — CID 47018908
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 47018908) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47018908 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(Cc2c(C)noc2C)C1=O |
| InChI | InChI=1S/C17H17N3O5/c1-4-24-14-8-6-5-7-13(14)20-16(22)15(21)19(17(20)23)9-12-10(2)18-25-11(12)3/h5-8H,4,9H2,1-3H3 |
| InChIKey | PUFGNLWVNJMNBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|