About 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile
2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile (PubChem CID 47021773) has the molecular formula C13H10F2N4
and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile.
Molecular Properties
| Compound Name | 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile |
| PubChem CID | 47021773 |
| Molecular Formula | C13H10F2N4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile |
| SMILES | N#CCCC(C#N)Cn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C13H10F2N4/c14-10-4-12-13(5-11(10)15)19(8-18-12)7-9(6-17)2-1-3-16/h4-5,8-9H,1-2,7H2 |
| InChIKey | DWPIDPPAVZHBBW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile?
The IUPAC name of 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile (CID 47021773) is 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile.
What is the SMILES notation for 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile?
The canonical SMILES for 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile is N#CCCC(C#N)Cn1cnc2cc(F)c(F)cc21.
What is the InChIKey of 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile?
The InChIKey is DWPIDPPAVZHBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N4/c14-10-4-12-13(5-11(10)15)19(8-18-12)7-9(6-17)2-1-3-16/h4-5,8-9H,1-2,7H2.
What are the key properties of 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile?
2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile has a molecular weight of 260.25 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-difluorobenzimidazol-1-yl)methyl]pentanedinitrile is sourced from PubChem (CID 47021773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).