C16H14Br2Cl2N2 — CID 4702186
1,15-bis(bromomethyl)-6,7-dichloro-15-methyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene (PubChem CID 4702186) has the molecular formula C16H14Br2Cl2N2 and a molecular weight of 465.02 g/mol. Its IUPAC name is 1,15-bis(bromomethyl)-6,7-dichloro-15-methyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene.
| Compound Name | 1,15-bis(bromomethyl)-6,7-dichloro-15-methyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 4702186 |
| Molecular Formula | C16H14Br2Cl2N2 |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 461.89 |
| IUPAC Name | 1,15-bis(bromomethyl)-6,7-dichloro-15-methyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
| SMILES | CC1(CBr)C2CCC1(CBr)c1nc3cc(Cl)c(Cl)cc3nc12 |
| InChI | InChI=1S/C16H14Br2Cl2N2/c1-15(6-17)8-2-3-16(15,7-18)14-13(8)21-11-4-9(19)10(20)5-12(11)22-14/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | KTPUHCVQFOHYGP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|