C18H19F3N2 — CID 4702191
1,12,15,15-tetramethyl-6-(trifluoromethyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene (PubChem CID 4702191) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1,12,15,15-tetramethyl-6-(trifluoromethyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene.
| Compound Name | 1,12,15,15-tetramethyl-6-(trifluoromethyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene |
|---|---|
| PubChem CID | 4702191 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1,12,15,15-tetramethyl-6-(trifluoromethyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene |
| SMILES | CC12CCC(C)(c3nc4cc(C(F)(F)F)ccc4nc31)C2(C)C |
| InChI | InChI=1S/C18H19F3N2/c1-15(2)16(3)7-8-17(15,4)14-13(16)22-11-6-5-10(18(19,20)21)9-12(11)23-14/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | XLSCLUADFPCNNH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |