C22H21N3O7 — CID 47023121
3-[[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 47023121) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is 3-[[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 47023121 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]methyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2c(c1)OCCO2)C1CCN(Cn2c(=O)oc3ccc([N+](=O)[O-])cc32)CC1 |
| InChI | InChI=1S/C22H21N3O7/c26-21(15-1-3-19-20(11-15)31-10-9-30-19)14-5-7-23(8-6-14)13-24-17-12-16(25(28)29)2-4-18(17)32-22(24)27/h1-4,11-12,14H,5-10,13H2 |
| InChIKey | MLGXIHFBXLBXHE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|